tert-Butyl Methyl Ether
![eMolecules 27904-92-3 | TERT-BUTYL N-[(PHENYLCARBAMOYL)METHYL]CARBAMATE | AstaTech | MFCD10043451 | 250.298 | C13H18N2O3 | 95.000 | CC(C)(C)OC(=O)NCC(=O)Nc1ccccc1 | 0.1g | 696740607](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502461933.JPG-250.jpg)
eMolecules 27904-92-3 | TERT-BUTYL N-[(PHENYLCARBAMOYL)METHYL]CARBAMATE | AstaTech | MFCD10043451 | 250.298 | C13H18N2O3 | 95.000 | CC(C)(C)OC(=O)NCC(=O)Nc1ccccc1 | 0.1g | 696740607
TERT-BUTYL N-[(PHENYLCARBAMOYL)METHYL]CARBAMATE | AstaTech | 27904-92-3 | MFCD10043451 | 250.298 | C13H18N2O3 | 95.000 | CC(C)(C)OC(=O)NCC(=O)Nc1ccccc1 | 0.1g | 696740607
eMolecules 1634-04-4 | MTBE ACS grade | Oakwood Chemicals | MFCD00008812 | 88.150 | C5H12O | 99.000 | COC(C)(C)C | 100g | 480150630
MTBE ACS grade | Oakwood Chemicals | 1634-04-4 | MFCD00008812 | 88.150 | C5H12O | 99.000 | COC(C)(C)C | 100g | 480150630
Cambridge Isotope Laboratories Bisphenol F diglycidyl ether (BFDGE) (unlabeled) 100 ug/mL in acetonitrile 1 2 mL
Bisphenol F diglycidyl ether (BFDGE) (unlabeled) 100 ug/mL in acetonitrile 1 2 mL
Sigma Aldrich Fine Chemicals Biosciences tert-Butyl methyl ether puriss. p.a., >=99.5% (GC) | 1634-04-4 | MFCD00008812 | 1L
tert-Butyl methyl ether puriss. p.a., >=99.5% (GC) | Purity: >=99.5% (GC) | Mol Wt: 88.15 | 1634-04-4 | MFCD00008812 | 1L
Sigma Aldrich Fine Chemicals Biosciences Tert-Butyl Methyl Ether | 1634-04-4 | MFCD00008812 | 4l
Tert-Butyl Methyl Ether | Purity: 98% | Mol Wt: 88.15 | 1634-04-4 | MFCD00008812 | 4l
Sigma Aldrich Fine Chemicals Biosciences tert Butyl methyl ether AC
tert-Butyl methyl ether (methyl tert-butyl ether MTBE) is a gasoline additive. Its oxidative degradation by propane-oxidizing bacterial strains has been tested. Kinetics of its heat-mediated biodegradation has been investigated under various reaction conditions. Its biodegradation followed a pseudo-first-order decay model and its pseudo-first-order rate constants were evaluated. Its extraction from water has been proposed by employing an organic polymeric compound Nafion. MTBE can be synthesized by acid-catalyzed reaction between methanol and isobutene. A study suggests that the addition of MTBE increases the number of active sites during polymerization of propene by stopped-flow method. This solvent meets ACS (American Chemical Society) specifications and can be used for processes requiring strict quality conditions such as analytical testing.
Sigma Aldrich Fine Chemicals Biosciences tert Butyl methyl ether su
tert-Butyl methyl ether (methyl tert-butyl ether MTBE) is a gasoline additive. Its oxidative degradation by propane-oxidizing bacterial strains has been tested. Kinetic studies of its heat-assisted persulfate oxidation at various pH temperature oxidant concentration and ionic strength levels suggests that reaction exhibits a pseudo-first-order decay model.
Sigma Aldrich Fine Chemicals Biosciences tert-Butyl methyl ether | 1634-04-4 | MFCD00008812 | 2.5 L
tert-Butyl methyl ether | Purity: ≥99.0% | Mol Wt: 88.15 | 1634-04-4 | MFCD00008812 | 2.5 L
eMolecules 1628679-52-6 | PEG2-MeN-Boc | ChemScene219.281 | C10H21NO4 | 97.000 | CN(CCOCCO)C(=O)OC(C)(C)C | 100mg | 686213862
PEG2-MeN-Boc | ChemScene | 1628679-52-6219.281 | C10H21NO4 | 97.000 | CN(CCOCCO)C(=O)OC(C)(C)C | 100mg | 686213862